C8H11N5O4S — CID 114134553
5-(hydroxymethyl)-2-methyl-N-(2H-tetrazol-5-ylmethyl)furan-3-sulfonamide (PubChem CID 114134553) has the molecular formula C8H11N5O4S and a molecular weight of 273.27 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2-methyl-N-(2H-tetrazol-5-ylmethyl)furan-3-sulfonamide.
| Compound Name | 5-(hydroxymethyl)-2-methyl-N-(2H-tetrazol-5-ylmethyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 114134553 |
| Molecular Formula | C8H11N5O4S |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 5-(hydroxymethyl)-2-methyl-N-(2H-tetrazol-5-ylmethyl)furan-3-sulfonamide |
| SMILES | Cc1oc(CO)cc1S(=O)(=O)NCc1nn[nH]n1 |
| InChI | InChI=1S/C8H11N5O4S/c1-5-7(2-6(4-14)17-5)18(15,16)9-3-8-10-12-13-11-8/h2,9,14H,3-4H2,1H3,(H,10,11,12,13) |
| InChIKey | IAMLYYMRAZWDJJ-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 134.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |