C12H10ClN3O4S — CID 46535229
N-[4-[(4-chloro-2-nitrophenoxy)methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 46535229) has the molecular formula C12H10ClN3O4S and a molecular weight of 327.75 g/mol. Its IUPAC name is N-[4-[(4-chloro-2-nitrophenoxy)methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-[(4-chloro-2-nitrophenoxy)methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 46535229 |
| Molecular Formula | C12H10ClN3O4S |
| Molecular Weight | 327.75 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | N-[4-[(4-chloro-2-nitrophenoxy)methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(COc2ccc(Cl)cc2[N+](=O)[O-])cs1 |
| InChI | InChI=1S/C12H10ClN3O4S/c1-7(17)14-12-15-9(6-21-12)5-20-11-3-2-8(13)4-10(11)16(18)19/h2-4,6H,5H2,1H3,(H,14,15,17) |
| InChIKey | JITOPOYTEMBXCL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.75 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|