C10H7Cl2N3O3S — CID 107499877
4-[(4,5-dichloro-2-nitrophenoxy)methyl]-1,3-thiazol-2-amine (PubChem CID 107499877) has the molecular formula C10H7Cl2N3O3S and a molecular weight of 320.16 g/mol. Its IUPAC name is 4-[(4,5-dichloro-2-nitrophenoxy)methyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[(4,5-dichloro-2-nitrophenoxy)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 107499877 |
| Molecular Formula | C10H7Cl2N3O3S |
| Molecular Weight | 320.16 g/mol |
| Exact Mass | 318.96 |
| IUPAC Name | 4-[(4,5-dichloro-2-nitrophenoxy)methyl]-1,3-thiazol-2-amine |
| SMILES | Nc1nc(COc2cc(Cl)c(Cl)cc2[N+](=O)[O-])cs1 |
| InChI | InChI=1S/C10H7Cl2N3O3S/c11-6-1-8(15(16)17)9(2-7(6)12)18-3-5-4-19-10(13)14-5/h1-2,4H,3H2,(H2,13,14) |
| InChIKey | WHSGJFRMIOBGEC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.16 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|