C21H19ClN4O5 — CID 135729865
(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl 3-nitro-4-piperidin-1-ylbenzoate (PubChem CID 135729865) has the molecular formula C21H19ClN4O5 and a molecular weight of 442.86 g/mol. Its IUPAC name is (7-chloro-4-oxo-3H-quinazolin-2-yl)methyl 3-nitro-4-piperidin-1-ylbenzoate.
| Compound Name | (7-chloro-4-oxo-3H-quinazolin-2-yl)methyl 3-nitro-4-piperidin-1-ylbenzoate |
|---|---|
| PubChem CID | 135729865 |
| Molecular Formula | C21H19ClN4O5 |
| Molecular Weight | 442.86 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | (7-chloro-4-oxo-3H-quinazolin-2-yl)methyl 3-nitro-4-piperidin-1-ylbenzoate |
| SMILES | O=C(OCc1nc2cc(Cl)ccc2c(=O)[nH]1)c1ccc(N2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H19ClN4O5/c22-14-5-6-15-16(11-14)23-19(24-20(15)27)12-31-21(28)13-4-7-17(18(10-13)26(29)30)25-8-2-1-3-9-25/h4-7,10-11H,1-3,8-9,12H2,(H,23,24,27) |
| InChIKey | DCDMBANSCMAVLA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 118.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.86 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|