C14H8ClN3O5S — CID 135600178
(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-chloro-5-nitrobenzoate (PubChem CID 135600178) has the molecular formula C14H8ClN3O5S and a molecular weight of 365.75 g/mol. Its IUPAC name is (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-chloro-5-nitrobenzoate.
| Compound Name | (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 135600178 |
| Molecular Formula | C14H8ClN3O5S |
| Molecular Weight | 365.75 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-chloro-5-nitrobenzoate |
| SMILES | O=C(OCc1nc2ccsc2c(=O)[nH]1)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C14H8ClN3O5S/c15-9-2-1-7(18(21)22)5-8(9)14(20)23-6-11-16-10-3-4-24-12(10)13(19)17-11/h1-5H,6H2,(H,16,17,19) |
| InChIKey | DYXFFOHGGIHQHD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.75 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|