C14H10ClN3O3S — CID 135787521
(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-amino-4-chlorobenzoate (PubChem CID 135787521) has the molecular formula C14H10ClN3O3S and a molecular weight of 335.77 g/mol. Its IUPAC name is (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-amino-4-chlorobenzoate.
| Compound Name | (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 135787521 |
| Molecular Formula | C14H10ClN3O3S |
| Molecular Weight | 335.77 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-amino-4-chlorobenzoate |
| SMILES | Nc1cc(Cl)ccc1C(=O)OCc1nc2ccsc2c(=O)[nH]1 |
| InChI | InChI=1S/C14H10ClN3O3S/c15-7-1-2-8(9(16)5-7)14(20)21-6-11-17-10-3-4-22-12(10)13(19)18-11/h1-5H,6,16H2,(H,17,18,19) |
| InChIKey | BWCOTSWBRFZUBL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.77 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|