About butan-2-yl 2-chloro-5-nitrobenzoate
butan-2-yl 2-chloro-5-nitrobenzoate (PubChem CID 63841314) has the molecular formula C11H12ClNO4
and a molecular weight of 257.67 g/mol. Its IUPAC name is butan-2-yl 2-chloro-5-nitrobenzoate.
Molecular Properties
| Compound Name | butan-2-yl 2-chloro-5-nitrobenzoate |
| PubChem CID | 63841314 |
| Molecular Formula | C11H12ClNO4 |
| Molecular Weight | 257.67 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | butan-2-yl 2-chloro-5-nitrobenzoate |
| SMILES | CCC(C)OC(=O)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C11H12ClNO4/c1-3-7(2)17-11(14)9-6-8(13(15)16)4-5-10(9)12/h4-7H,3H2,1-2H3 |
| InChIKey | CCIAVWLKFFNSPY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.67 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze butan-2-yl 2-chloro-5-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl 2-chloro-5-nitrobenzoate?
The IUPAC name of butan-2-yl 2-chloro-5-nitrobenzoate (CID 63841314) is butan-2-yl 2-chloro-5-nitrobenzoate.
What is the SMILES notation for butan-2-yl 2-chloro-5-nitrobenzoate?
The canonical SMILES for butan-2-yl 2-chloro-5-nitrobenzoate is CCC(C)OC(=O)c1cc([N+](=O)[O-])ccc1Cl.
What is the InChIKey of butan-2-yl 2-chloro-5-nitrobenzoate?
The InChIKey is CCIAVWLKFFNSPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO4/c1-3-7(2)17-11(14)9-6-8(13(15)16)4-5-10(9)12/h4-7H,3H2,1-2H3.
What are the key properties of butan-2-yl 2-chloro-5-nitrobenzoate?
butan-2-yl 2-chloro-5-nitrobenzoate has a molecular weight of 257.67 g/mol, XLogP of 3.20, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl 2-chloro-5-nitrobenzoate is sourced from PubChem (CID 63841314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).