C13H15ClN2O5 — CID 60828418
2-[butan-2-yl-(2-chloro-5-nitrobenzoyl)amino]acetic acid (PubChem CID 60828418) has the molecular formula C13H15ClN2O5 and a molecular weight of 314.73 g/mol. Its IUPAC name is 2-[butan-2-yl-(2-chloro-5-nitrobenzoyl)amino]acetic acid.
| Compound Name | 2-[butan-2-yl-(2-chloro-5-nitrobenzoyl)amino]acetic acid |
|---|---|
| PubChem CID | 60828418 |
| Molecular Formula | C13H15ClN2O5 |
| Molecular Weight | 314.73 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-[butan-2-yl-(2-chloro-5-nitrobenzoyl)amino]acetic acid |
| SMILES | CCC(C)N(CC(=O)O)C(=O)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C13H15ClN2O5/c1-3-8(2)15(7-12(17)18)13(19)10-6-9(16(20)21)4-5-11(10)14/h4-6,8H,3,7H2,1-2H3,(H,17,18) |
| InChIKey | DIPPKKFOPLAKQE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.73 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|