C12H13NO6 — CID 10264953
2-[2-nitro-5-(oxiran-2-ylmethoxy)phenyl]-1,3-dioxolane (PubChem CID 10264953) has the molecular formula C12H13NO6 and a molecular weight of 267.24 g/mol. Its IUPAC name is 2-[2-nitro-5-(oxiran-2-ylmethoxy)phenyl]-1,3-dioxolane.
| Compound Name | 2-[2-nitro-5-(oxiran-2-ylmethoxy)phenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 10264953 |
| Molecular Formula | C12H13NO6 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 2-[2-nitro-5-(oxiran-2-ylmethoxy)phenyl]-1,3-dioxolane |
| SMILES | O=[N+]([O-])c1ccc(OCC2CO2)cc1C1OCCO1 |
| InChI | InChI=1S/C12H13NO6/c14-13(15)11-2-1-8(18-6-9-7-19-9)5-10(11)12-16-3-4-17-12/h1-2,5,9,12H,3-4,6-7H2 |
| InChIKey | UHFXHJYDHIHZGM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 83.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|