C13H15NO6 — CID 148511995
1-[3-(1,3-dioxolan-2-yl)-4-nitrophenoxy]-2-methylprop-2-en-1-ol (PubChem CID 148511995) has the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. Its IUPAC name is 1-[3-(1,3-dioxolan-2-yl)-4-nitrophenoxy]-2-methylprop-2-en-1-ol.
| Compound Name | 1-[3-(1,3-dioxolan-2-yl)-4-nitrophenoxy]-2-methylprop-2-en-1-ol |
|---|---|
| PubChem CID | 148511995 |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 1-[3-(1,3-dioxolan-2-yl)-4-nitrophenoxy]-2-methylprop-2-en-1-ol |
| SMILES | C=C(C)C(O)Oc1ccc([N+](=O)[O-])c(C2OCCO2)c1 |
| InChI | InChI=1S/C13H15NO6/c1-8(2)12(15)20-9-3-4-11(14(16)17)10(7-9)13-18-5-6-19-13/h3-4,7,12-13,15H,1,5-6H2,2H3 |
| InChIKey | MMRMYPFMRHEBFM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|