C17H16O6S — CID 126611596
4-[4-(1-hydroxy-2-methylprop-2-enoxy)benzoyl]benzenesulfonic acid (PubChem CID 126611596) has the molecular formula C17H16O6S and a molecular weight of 348.38 g/mol. Its IUPAC name is 4-[4-(1-hydroxy-2-methylprop-2-enoxy)benzoyl]benzenesulfonic acid.
| Compound Name | 4-[4-(1-hydroxy-2-methylprop-2-enoxy)benzoyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 126611596 |
| Molecular Formula | C17H16O6S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 4-[4-(1-hydroxy-2-methylprop-2-enoxy)benzoyl]benzenesulfonic acid |
| SMILES | C=C(C)C(O)Oc1ccc(C(=O)c2ccc(S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C17H16O6S/c1-11(2)17(19)23-14-7-3-12(4-8-14)16(18)13-5-9-15(10-6-13)24(20,21)22/h3-10,17,19H,1H2,2H3,(H,20,21,22) |
| InChIKey | UFGSXXIZMBORBP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|