C18H16Cl2N2O6 — CID 57098523
[N-acetyl-5-(2,4-dichlorophenoxy)-2-nitroanilino] butanoate (PubChem CID 57098523) has the molecular formula C18H16Cl2N2O6 and a molecular weight of 427.24 g/mol. Its IUPAC name is [N-acetyl-5-(2,4-dichlorophenoxy)-2-nitroanilino] butanoate.
| Compound Name | [N-acetyl-5-(2,4-dichlorophenoxy)-2-nitroanilino] butanoate |
|---|---|
| PubChem CID | 57098523 |
| Molecular Formula | C18H16Cl2N2O6 |
| Molecular Weight | 427.24 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | [N-acetyl-5-(2,4-dichlorophenoxy)-2-nitroanilino] butanoate |
| SMILES | CCCC(=O)ON(C(C)=O)c1cc(Oc2ccc(Cl)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16Cl2N2O6/c1-3-4-18(24)28-21(11(2)23)16-10-13(6-7-15(16)22(25)26)27-17-8-5-12(19)9-14(17)20/h5-10H,3-4H2,1-2H3 |
| InChIKey | LHAYZJGWCSGFJB-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.24 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|