C18H17F2NO4S — CID 139603752
O-butyl 5-(2,4-difluoro-3-methylphenoxy)-2-nitrobenzenecarbothioate (PubChem CID 139603752) has the molecular formula C18H17F2NO4S and a molecular weight of 381.40 g/mol. Its IUPAC name is O-butyl 5-(2,4-difluoro-3-methylphenoxy)-2-nitrobenzenecarbothioate.
| Compound Name | O-butyl 5-(2,4-difluoro-3-methylphenoxy)-2-nitrobenzenecarbothioate |
|---|---|
| PubChem CID | 139603752 |
| Molecular Formula | C18H17F2NO4S |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | O-butyl 5-(2,4-difluoro-3-methylphenoxy)-2-nitrobenzenecarbothioate |
| SMILES | CCCCOC(=S)c1cc(Oc2ccc(F)c(C)c2F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H17F2NO4S/c1-3-4-9-24-18(26)13-10-12(5-7-15(13)21(22)23)25-16-8-6-14(19)11(2)17(16)20/h5-8,10H,3-4,9H2,1-2H3 |
| InChIKey | YMFKMLMSLPAXPK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|