C26H24Br2Cl2N3O10P — CID 70136447
2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;3,5-dibromo-4-hydroxybenzonitrile;methyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate (PubChem CID 70136447) has the molecular formula C26H24Br2Cl2N3O10P and a molecular weight of 800.18 g/mol. Its IUPAC name is 2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;3,5-dibromo-4-hydroxybenzonitrile;methyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate.
| Compound Name | 2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;3,5-dibromo-4-hydroxybenzonitrile;methyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate |
|---|---|
| PubChem CID | 70136447 |
| Molecular Formula | C26H24Br2Cl2N3O10P |
| Molecular Weight | 800.18 g/mol |
| Exact Mass | 796.89 |
| IUPAC Name | 2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;3,5-dibromo-4-hydroxybenzonitrile;methyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate |
| SMILES | COC(=O)c1cc(Oc2ccc(Cl)cc2Cl)ccc1[N+](=O)[O-].CP(=O)(O)CCC(N)C(=O)O.N#Cc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C14H9Cl2NO5.C7H3Br2NO.C5H12NO4P/c1-21-14(18)10-7-9(3-4-12(10)17(19)20)22-13-5-2-8(15)6-11(13)16;8-5-1-4(3-10)2-6(9)7(5)11;1-11(9,10)3-2-4(6)5(7)8/h2-7H,1H3;1-2,11H;4H,2-3,6H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | VVVJXSGAPCYFJV-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 223.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.18 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|