C30H25Cl2N3O9 — CID 70137571
[3-(methoxycarbonylamino)phenyl] N-(3-methylphenyl)carbamate;methyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate (PubChem CID 70137571) has the molecular formula C30H25Cl2N3O9 and a molecular weight of 642.45 g/mol. Its IUPAC name is [3-(methoxycarbonylamino)phenyl] N-(3-methylphenyl)carbamate;methyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate.
| Compound Name | [3-(methoxycarbonylamino)phenyl] N-(3-methylphenyl)carbamate;methyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate |
|---|---|
| PubChem CID | 70137571 |
| Molecular Formula | C30H25Cl2N3O9 |
| Molecular Weight | 642.45 g/mol |
| Exact Mass | 641.10 |
| IUPAC Name | [3-(methoxycarbonylamino)phenyl] N-(3-methylphenyl)carbamate;methyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate |
| SMILES | COC(=O)Nc1cccc(OC(=O)Nc2cccc(C)c2)c1.COC(=O)c1cc(Oc2ccc(Cl)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16N2O4.C14H9Cl2NO5/c1-11-5-3-6-12(9-11)18-16(20)22-14-8-4-7-13(10-14)17-15(19)21-2;1-21-14(18)10-7-9(3-4-12(10)17(19)20)22-13-5-2-8(15)6-11(13)16/h3-10H,1-2H3,(H,17,19)(H,18,20);2-7H,1H3 |
| InChIKey | LQFBCRJQYGVMSF-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 155.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.45 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|