C29H22F12N4O2 — CID 161358571
2-amino-4-[2-(3-amino-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenol;4-[4-amino-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline (PubChem CID 161358571) has the molecular formula C29H22F12N4O2 and a molecular weight of 686.50 g/mol. Its IUPAC name is 2-amino-4-[2-(3-amino-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenol;4-[4-amino-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline.
| Compound Name | 2-amino-4-[2-(3-amino-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenol;4-[4-amino-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 161358571 |
| Molecular Formula | C29H22F12N4O2 |
| Molecular Weight | 686.50 g/mol |
| Exact Mass | 686.16 |
| IUPAC Name | 2-amino-4-[2-(3-amino-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenol;4-[4-amino-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline |
| SMILES | Nc1cc(C(c2ccc(O)c(N)c2)(C(F)(F)F)C(F)(F)F)ccc1O.Nc1ccc(-c2ccc(N)cc2C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H12F6N2O2.C14H10F6N2/c16-14(17,18)13(15(19,20)21,7-1-3-11(24)9(22)5-7)8-2-4-12(25)10(23)6-8;15-13(16,17)11-5-7(21)1-3-9(11)10-4-2-8(22)6-12(10)14(18,19)20/h1-6,24-25H,22-23H2;1-6H,21-22H2 |
| InChIKey | VOWFNABTCPOVKK-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 144.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.50 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|