C36H22F12N4O2 — CID 148615789
1-N,4-N-bis[4-[4-amino-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)phenyl]benzene-1,4-dicarboxamide (PubChem CID 148615789) has the molecular formula C36H22F12N4O2 and a molecular weight of 770.57 g/mol. Its IUPAC name is 1-N,4-N-bis[4-[4-amino-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)phenyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[4-[4-amino-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)phenyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 148615789 |
| Molecular Formula | C36H22F12N4O2 |
| Molecular Weight | 770.57 g/mol |
| Exact Mass | 770.16 |
| IUPAC Name | 1-N,4-N-bis[4-[4-amino-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)phenyl]benzene-1,4-dicarboxamide |
| SMILES | Nc1ccc(-c2ccc(NC(=O)c3ccc(C(=O)Nc4ccc(-c5ccc(N)cc5C(F)(F)F)c(C(F)(F)F)c4)cc3)cc2C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C36H22F12N4O2/c37-33(38,39)27-13-19(49)5-9-23(27)25-11-7-21(15-29(25)35(43,44)45)51-31(53)17-1-2-18(4-3-17)32(54)52-22-8-12-26(30(16-22)36(46,47)48)24-10-6-20(50)14-28(24)34(40,41)42/h1-16H,49-50H2,(H,51,53)(H,52,54) |
| InChIKey | NFGUFMSZDCRGGY-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.57 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|