C26H24F6N2O2 — CID 142377854
N-[4-[4-amino-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)phenyl]-4-formylbenzamide;2-methylpropane (PubChem CID 142377854) has the molecular formula C26H24F6N2O2 and a molecular weight of 510.48 g/mol. Its IUPAC name is N-[4-[4-amino-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)phenyl]-4-formylbenzamide;2-methylpropane.
| Compound Name | N-[4-[4-amino-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)phenyl]-4-formylbenzamide;2-methylpropane |
|---|---|
| PubChem CID | 142377854 |
| Molecular Formula | C26H24F6N2O2 |
| Molecular Weight | 510.48 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | N-[4-[4-amino-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)phenyl]-4-formylbenzamide;2-methylpropane |
| SMILES | CC(C)C.Nc1ccc(-c2ccc(NC(=O)c3ccc(C=O)cc3)cc2C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H14F6N2O2.C4H10/c23-21(24,25)18-9-14(29)5-7-16(18)17-8-6-15(10-19(17)22(26,27)28)30-20(32)13-3-1-12(11-31)2-4-13;1-4(2)3/h1-11H,29H2,(H,30,32);4H,1-3H3 |
| InChIKey | BANDQLBKZAHGRQ-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.48 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|