C36H34N8O5 — CID 174723644
4-[3-[2,3-bis(2,4-diaminophenoxy)phenoxy]-2-(2,4-diaminophenoxy)phenoxy]benzene-1,3-diamine (PubChem CID 174723644) has the molecular formula C36H34N8O5 and a molecular weight of 658.72 g/mol. Its IUPAC name is 4-[3-[2,3-bis(2,4-diaminophenoxy)phenoxy]-2-(2,4-diaminophenoxy)phenoxy]benzene-1,3-diamine.
| Compound Name | 4-[3-[2,3-bis(2,4-diaminophenoxy)phenoxy]-2-(2,4-diaminophenoxy)phenoxy]benzene-1,3-diamine |
|---|---|
| PubChem CID | 174723644 |
| Molecular Formula | C36H34N8O5 |
| Molecular Weight | 658.72 g/mol |
| Exact Mass | 658.27 |
| IUPAC Name | 4-[3-[2,3-bis(2,4-diaminophenoxy)phenoxy]-2-(2,4-diaminophenoxy)phenoxy]benzene-1,3-diamine |
| SMILES | Nc1ccc(Oc2cccc(Oc3cccc(Oc4ccc(N)cc4N)c3Oc3ccc(N)cc3N)c2Oc2ccc(N)cc2N)c(N)c1 |
| InChI | InChI=1S/C36H34N8O5/c37-19-7-11-27(23(41)15-19)45-31-3-1-5-33(35(31)48-29-13-9-21(39)17-25(29)43)47-34-6-2-4-32(46-28-12-8-20(38)16-24(28)42)36(34)49-30-14-10-22(40)18-26(30)44/h1-18H,37-44H2 |
| InChIKey | MIMBZUQYRZVOSM-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 254.31 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.72 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|