C22H20N4O2 — CID 141165194
4-[8-(2,4-diaminophenoxy)naphthalen-2-yl]oxybenzene-1,3-diamine (PubChem CID 141165194) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 4-[8-(2,4-diaminophenoxy)naphthalen-2-yl]oxybenzene-1,3-diamine.
| Compound Name | 4-[8-(2,4-diaminophenoxy)naphthalen-2-yl]oxybenzene-1,3-diamine |
|---|---|
| PubChem CID | 141165194 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 4-[8-(2,4-diaminophenoxy)naphthalen-2-yl]oxybenzene-1,3-diamine |
| SMILES | Nc1ccc(Oc2ccc3cccc(Oc4ccc(N)cc4N)c3c2)c(N)c1 |
| InChI | InChI=1S/C22H20N4O2/c23-14-5-8-21(18(25)10-14)27-16-7-4-13-2-1-3-20(17(13)12-16)28-22-9-6-15(24)11-19(22)26/h1-12H,23-26H2 |
| InChIKey | KOEGGDZCMXNZSL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|