C27H22F6N4O2 — CID 57118558
2,2-bis[2-(4-aminophenoxy)phenyl]-1-N',1-N',1,3,3,3-hexafluoropropane-1,1-diamine (PubChem CID 57118558) has the molecular formula C27H22F6N4O2 and a molecular weight of 548.49 g/mol. Its IUPAC name is 2,2-bis[2-(4-aminophenoxy)phenyl]-1-N',1-N',1,3,3,3-hexafluoropropane-1,1-diamine.
| Compound Name | 2,2-bis[2-(4-aminophenoxy)phenyl]-1-N',1-N',1,3,3,3-hexafluoropropane-1,1-diamine |
|---|---|
| PubChem CID | 57118558 |
| Molecular Formula | C27H22F6N4O2 |
| Molecular Weight | 548.49 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | 2,2-bis[2-(4-aminophenoxy)phenyl]-1-N',1-N',1,3,3,3-hexafluoropropane-1,1-diamine |
| SMILES | Nc1ccc(Oc2ccccc2C(c2ccccc2Oc2ccc(N)cc2)(C(F)(F)F)C(N)(F)N(F)F)cc1 |
| InChI | InChI=1S/C27H22F6N4O2/c28-26(29,30)25(27(31,36)37(32)33,21-5-1-3-7-23(21)38-19-13-9-17(34)10-14-19)22-6-2-4-8-24(22)39-20-15-11-18(35)12-16-20/h1-16H,34-36H2 |
| InChIKey | AEDRRMTYDSXVHU-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.49 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|