C27H16F6N2O6 — CID 139816676
1-[1,1,1,3,3,3-hexafluoro-2-[2-(4-nitrophenoxy)phenyl]propan-2-yl]-2-(4-nitrophenoxy)benzene (PubChem CID 139816676) has the molecular formula C27H16F6N2O6 and a molecular weight of 578.42 g/mol. Its IUPAC name is 1-[1,1,1,3,3,3-hexafluoro-2-[2-(4-nitrophenoxy)phenyl]propan-2-yl]-2-(4-nitrophenoxy)benzene.
| Compound Name | 1-[1,1,1,3,3,3-hexafluoro-2-[2-(4-nitrophenoxy)phenyl]propan-2-yl]-2-(4-nitrophenoxy)benzene |
|---|---|
| PubChem CID | 139816676 |
| Molecular Formula | C27H16F6N2O6 |
| Molecular Weight | 578.42 g/mol |
| Exact Mass | 578.09 |
| IUPAC Name | 1-[1,1,1,3,3,3-hexafluoro-2-[2-(4-nitrophenoxy)phenyl]propan-2-yl]-2-(4-nitrophenoxy)benzene |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccccc2C(c2ccccc2Oc2ccc([N+](=O)[O-])cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H16F6N2O6/c28-26(29,30)25(27(31,32)33,21-5-1-3-7-23(21)40-19-13-9-17(10-14-19)34(36)37)22-6-2-4-8-24(22)41-20-15-11-18(12-16-20)35(38)39/h1-16H |
| InChIKey | NRPCMHYXAXPZRT-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.42 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|