C20H11F6NO4 — CID 97178511
2-nitro-1,4-bis[2-(trifluoromethyl)phenoxy]benzene (PubChem CID 97178511) has the molecular formula C20H11F6NO4 and a molecular weight of 443.30 g/mol. Its IUPAC name is 2-nitro-1,4-bis[2-(trifluoromethyl)phenoxy]benzene.
| Compound Name | 2-nitro-1,4-bis[2-(trifluoromethyl)phenoxy]benzene |
|---|---|
| PubChem CID | 97178511 |
| Molecular Formula | C20H11F6NO4 |
| Molecular Weight | 443.30 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | 2-nitro-1,4-bis[2-(trifluoromethyl)phenoxy]benzene |
| SMILES | O=[N+]([O-])c1cc(Oc2ccccc2C(F)(F)F)ccc1Oc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H11F6NO4/c21-19(22,23)13-5-1-3-7-16(13)30-12-9-10-18(15(11-12)27(28)29)31-17-8-4-2-6-14(17)20(24,25)26/h1-11H |
| InChIKey | JPCXUWGGFPAFJF-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.30 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|