C45H33F6N3O3 — CID 158382375
4-[4-[2-[4-(4-aminophenoxy)-2-[2-(4-aminophenoxy)phenyl]-3-phenylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]aniline (PubChem CID 158382375) has the molecular formula C45H33F6N3O3 and a molecular weight of 777.77 g/mol. Its IUPAC name is 4-[4-[2-[4-(4-aminophenoxy)-2-[2-(4-aminophenoxy)phenyl]-3-phenylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]aniline.
| Compound Name | 4-[4-[2-[4-(4-aminophenoxy)-2-[2-(4-aminophenoxy)phenyl]-3-phenylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]aniline |
|---|---|
| PubChem CID | 158382375 |
| Molecular Formula | C45H33F6N3O3 |
| Molecular Weight | 777.77 g/mol |
| Exact Mass | 777.24 |
| IUPAC Name | 4-[4-[2-[4-(4-aminophenoxy)-2-[2-(4-aminophenoxy)phenyl]-3-phenylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]aniline |
| SMILES | Nc1ccc(Oc2ccc(C(c3ccc(Oc4ccc(N)cc4)c(-c4ccccc4)c3-c3ccccc3Oc3ccc(N)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C45H33F6N3O3/c46-44(47,48)43(45(49,50)51,29-10-18-33(19-11-29)55-34-20-12-30(52)13-21-34)38-26-27-40(57-36-24-16-32(54)17-25-36)41(28-6-2-1-3-7-28)42(38)37-8-4-5-9-39(37)56-35-22-14-31(53)15-23-35/h1-27H,52-54H2 |
| InChIKey | GVYLVAMQHCBCSG-UHFFFAOYSA-N |
| XLogP | 12.55 |
| TPSA | 105.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.77 |
| LogP ≤ 5 | 12.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|