C9H5ClF6O — CID 95474245
(2S)-2-(4-chlorophenyl)-1,1,2,3,3,3-hexafluoropropan-1-ol (PubChem CID 95474245) has the molecular formula C9H5ClF6O and a molecular weight of 278.58 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)-1,1,2,3,3,3-hexafluoropropan-1-ol.
| Compound Name | (2S)-2-(4-chlorophenyl)-1,1,2,3,3,3-hexafluoropropan-1-ol |
|---|---|
| PubChem CID | 95474245 |
| Molecular Formula | C9H5ClF6O |
| Molecular Weight | 278.58 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)-1,1,2,3,3,3-hexafluoropropan-1-ol |
| SMILES | OC(F)(F)[C@@](F)(c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C9H5ClF6O/c10-6-3-1-5(2-4-6)7(11,8(12,13)14)9(15,16)17/h1-4,17H/t7-/m1/s1 |
| InChIKey | FXUSJRWPZMRZNJ-SSDOTTSWSA-N |
| XLogP | 3.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.58 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |