C16H10Cl2F6O — CID 160769691
2,3-bis(4-chlorophenyl)-1,1,1,4,4,4-hexafluorobutan-2-ol (PubChem CID 160769691) has the molecular formula C16H10Cl2F6O and a molecular weight of 403.15 g/mol. Its IUPAC name is 2,3-bis(4-chlorophenyl)-1,1,1,4,4,4-hexafluorobutan-2-ol.
| Compound Name | 2,3-bis(4-chlorophenyl)-1,1,1,4,4,4-hexafluorobutan-2-ol |
|---|---|
| PubChem CID | 160769691 |
| Molecular Formula | C16H10Cl2F6O |
| Molecular Weight | 403.15 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | 2,3-bis(4-chlorophenyl)-1,1,1,4,4,4-hexafluorobutan-2-ol |
| SMILES | OC(c1ccc(Cl)cc1)(C(c1ccc(Cl)cc1)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H10Cl2F6O/c17-11-5-1-9(2-6-11)13(15(19,20)21)14(25,16(22,23)24)10-3-7-12(18)8-4-10/h1-8,13,25H |
| InChIKey | VLWJXBSPLLSEFQ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.15 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |