C15H16F7NOS — CID 141365232
O-tert-butyl 2-[2-amino-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]ethanethioate (PubChem CID 141365232) has the molecular formula C15H16F7NOS and a molecular weight of 391.35 g/mol. Its IUPAC name is O-tert-butyl 2-[2-amino-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]ethanethioate.
| Compound Name | O-tert-butyl 2-[2-amino-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]ethanethioate |
|---|---|
| PubChem CID | 141365232 |
| Molecular Formula | C15H16F7NOS |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | O-tert-butyl 2-[2-amino-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]ethanethioate |
| SMILES | CC(C)(C)OC(=S)Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc1N |
| InChI | InChI=1S/C15H16F7NOS/c1-12(2,3)24-11(25)7-8-6-9(4-5-10(8)23)13(16,14(17,18)19)15(20,21)22/h4-6H,7,23H2,1-3H3 |
| InChIKey | GSBJTQWCAPYSGT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|