C13H16F5NO2S — CID 163574230
2-methylbut-3-en-2-yl 2-[2-amino-5-(pentafluoro-λ6-sulfanyl)phenyl]acetate (PubChem CID 163574230) has the molecular formula C13H16F5NO2S and a molecular weight of 345.33 g/mol. Its IUPAC name is 2-methylbut-3-en-2-yl 2-[2-amino-5-(pentafluoro-λ6-sulfanyl)phenyl]acetate.
| Compound Name | 2-methylbut-3-en-2-yl 2-[2-amino-5-(pentafluoro-λ6-sulfanyl)phenyl]acetate |
|---|---|
| PubChem CID | 163574230 |
| Molecular Formula | C13H16F5NO2S |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 2-methylbut-3-en-2-yl 2-[2-amino-5-(pentafluoro-λ6-sulfanyl)phenyl]acetate |
| SMILES | C=CC(C)(C)OC(=O)Cc1cc(S(F)(F)(F)(F)F)ccc1N |
| InChI | InChI=1S/C13H16F5NO2S/c1-4-13(2,3)21-12(20)8-9-7-10(5-6-11(9)19)22(14,15,16,17)18/h4-7H,1,8,19H2,2-3H3 |
| InChIKey | GCAPTUOCCJLFKP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|