C10H14FN5O2 — CID 171879429
4-azido-1-(3-fluoro-4-hydrazinylphenyl)butane-1,2-diol (PubChem CID 171879429) has the molecular formula C10H14FN5O2 and a molecular weight of 255.25 g/mol. Its IUPAC name is 4-azido-1-(3-fluoro-4-hydrazinylphenyl)butane-1,2-diol.
| Compound Name | 4-azido-1-(3-fluoro-4-hydrazinylphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171879429 |
| Molecular Formula | C10H14FN5O2 |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 4-azido-1-(3-fluoro-4-hydrazinylphenyl)butane-1,2-diol |
| SMILES | [N-]=[N+]=NCCC(O)C(O)c1ccc(NN)c(F)c1 |
| InChI | InChI=1S/C10H14FN5O2/c11-7-5-6(1-2-8(7)15-12)10(18)9(17)3-4-14-16-13/h1-2,5,9-10,15,17-18H,3-4,12H2 |
| InChIKey | DRLFCYMENJHLDP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 127.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|