C12H13N3O2 — CID 171879017
4-azido-1-(4-ethynylphenyl)butane-1,2-diol (PubChem CID 171879017) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 4-azido-1-(4-ethynylphenyl)butane-1,2-diol.
| Compound Name | 4-azido-1-(4-ethynylphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171879017 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 4-azido-1-(4-ethynylphenyl)butane-1,2-diol |
| SMILES | C#Cc1ccc(C(O)C(O)CCN=[N+]=[N-])cc1 |
| InChI | InChI=1S/C12H13N3O2/c1-2-9-3-5-10(6-4-9)12(17)11(16)7-8-14-15-13/h1,3-6,11-12,16-17H,7-8H2 |
| InChIKey | JFEDIXYJZSLQQQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|