C13H15N5O4 — CID 171880442
methyl 6-(4-azido-1,2-dihydroxybutyl)-1H-indazole-4-carboxylate (PubChem CID 171880442) has the molecular formula C13H15N5O4 and a molecular weight of 305.29 g/mol. Its IUPAC name is methyl 6-(4-azido-1,2-dihydroxybutyl)-1H-indazole-4-carboxylate.
| Compound Name | methyl 6-(4-azido-1,2-dihydroxybutyl)-1H-indazole-4-carboxylate |
|---|---|
| PubChem CID | 171880442 |
| Molecular Formula | C13H15N5O4 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | methyl 6-(4-azido-1,2-dihydroxybutyl)-1H-indazole-4-carboxylate |
| SMILES | COC(=O)c1cc(C(O)C(O)CCN=[N+]=[N-])cc2[nH]ncc12 |
| InChI | InChI=1S/C13H15N5O4/c1-22-13(21)8-4-7(5-10-9(8)6-16-17-10)12(20)11(19)2-3-15-18-14/h4-6,11-12,19-20H,2-3H2,1H3,(H,16,17) |
| InChIKey | AMOTWVMDSVKDQV-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 144.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|