C14H18N2O4 — CID 171882241
methyl 6-(4-amino-1,2-dihydroxybutyl)-1H-indole-4-carboxylate (PubChem CID 171882241) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is methyl 6-(4-amino-1,2-dihydroxybutyl)-1H-indole-4-carboxylate.
| Compound Name | methyl 6-(4-amino-1,2-dihydroxybutyl)-1H-indole-4-carboxylate |
|---|---|
| PubChem CID | 171882241 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | methyl 6-(4-amino-1,2-dihydroxybutyl)-1H-indole-4-carboxylate |
| SMILES | COC(=O)c1cc(C(O)C(O)CCN)cc2[nH]ccc12 |
| InChI | InChI=1S/C14H18N2O4/c1-20-14(19)10-6-8(13(18)12(17)2-4-15)7-11-9(10)3-5-16-11/h3,5-7,12-13,16-18H,2,4,15H2,1H3 |
| InChIKey | CSYQVKXAZCZHAJ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |