C10H11F2N3O3 — CID 171879424
4-azido-1-(2,6-difluoro-4-hydroxyphenyl)butane-1,2-diol (PubChem CID 171879424) has the molecular formula C10H11F2N3O3 and a molecular weight of 259.21 g/mol. Its IUPAC name is 4-azido-1-(2,6-difluoro-4-hydroxyphenyl)butane-1,2-diol.
| Compound Name | 4-azido-1-(2,6-difluoro-4-hydroxyphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171879424 |
| Molecular Formula | C10H11F2N3O3 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 4-azido-1-(2,6-difluoro-4-hydroxyphenyl)butane-1,2-diol |
| SMILES | [N-]=[N+]=NCCC(O)C(O)c1c(F)cc(O)cc1F |
| InChI | InChI=1S/C10H11F2N3O3/c11-6-3-5(16)4-7(12)9(6)10(18)8(17)1-2-14-15-13/h3-4,8,10,16-18H,1-2H2 |
| InChIKey | LAQSKSVQMFRLRJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 109.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|