C15H12F3NO4S — CID 68646210
[benzenesulfonyl-[2-(trifluoromethyl)phenyl]methyl]carbamic acid (PubChem CID 68646210) has the molecular formula C15H12F3NO4S and a molecular weight of 359.33 g/mol. Its IUPAC name is [benzenesulfonyl-[2-(trifluoromethyl)phenyl]methyl]carbamic acid.
| Compound Name | [benzenesulfonyl-[2-(trifluoromethyl)phenyl]methyl]carbamic acid |
|---|---|
| PubChem CID | 68646210 |
| Molecular Formula | C15H12F3NO4S |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | [benzenesulfonyl-[2-(trifluoromethyl)phenyl]methyl]carbamic acid |
| SMILES | O=C(O)NC(c1ccccc1C(F)(F)F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H12F3NO4S/c16-15(17,18)12-9-5-4-8-11(12)13(19-14(20)21)24(22,23)10-6-2-1-3-7-10/h1-9,13,19H,(H,20,21) |
| InChIKey | JFRBETJFSJBEGD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |