C15H15F3NO2S+ — CID 9167976
[(2R)-2-(benzenesulfonyl)-2-[2-(trifluoromethyl)phenyl]ethyl]azanium (PubChem CID 9167976) has the molecular formula C15H15F3NO2S+ and a molecular weight of 330.35 g/mol. Its IUPAC name is [(2R)-2-(benzenesulfonyl)-2-[2-(trifluoromethyl)phenyl]ethyl]azanium.
| Compound Name | [(2R)-2-(benzenesulfonyl)-2-[2-(trifluoromethyl)phenyl]ethyl]azanium |
|---|---|
| PubChem CID | 9167976 |
| Molecular Formula | C15H15F3NO2S+ |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | [(2R)-2-(benzenesulfonyl)-2-[2-(trifluoromethyl)phenyl]ethyl]azanium |
| SMILES | [NH3+]C[C@@H](c1ccccc1C(F)(F)F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H14F3NO2S/c16-15(17,18)13-9-5-4-8-12(13)14(10-19)22(20,21)11-6-2-1-3-7-11/h1-9,14H,10,19H2/p+1/t14-/m0/s1 |
| InChIKey | XBTAJGRIGJITGL-AWEZNQCLSA-O |
| XLogP | 2.46 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |