C17H22NO2S+ — CID 9168569
[(2R)-2-(benzenesulfonyl)-2-(4-propan-2-ylphenyl)ethyl]azanium (PubChem CID 9168569) has the molecular formula C17H22NO2S+ and a molecular weight of 304.44 g/mol. Its IUPAC name is [(2R)-2-(benzenesulfonyl)-2-(4-propan-2-ylphenyl)ethyl]azanium.
| Compound Name | [(2R)-2-(benzenesulfonyl)-2-(4-propan-2-ylphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 9168569 |
| Molecular Formula | C17H22NO2S+ |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | [(2R)-2-(benzenesulfonyl)-2-(4-propan-2-ylphenyl)ethyl]azanium |
| SMILES | CC(C)c1ccc([C@H](C[NH3+])S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H21NO2S/c1-13(2)14-8-10-15(11-9-14)17(12-18)21(19,20)16-6-4-3-5-7-16/h3-11,13,17H,12,18H2,1-2H3/p+1/t17-/m0/s1 |
| InChIKey | DYLMZBSIKIIWHV-KRWDZBQOSA-O |
| XLogP | 2.57 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |