C16H16F3NO2S — CID 9168030
(2R)-2-(4-methylphenyl)sulfonyl-2-[2-(trifluoromethyl)phenyl]ethanamine (PubChem CID 9168030) has the molecular formula C16H16F3NO2S and a molecular weight of 343.37 g/mol. Its IUPAC name is (2R)-2-(4-methylphenyl)sulfonyl-2-[2-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | (2R)-2-(4-methylphenyl)sulfonyl-2-[2-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 9168030 |
| Molecular Formula | C16H16F3NO2S |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | (2R)-2-(4-methylphenyl)sulfonyl-2-[2-(trifluoromethyl)phenyl]ethanamine |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H](CN)c2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H16F3NO2S/c1-11-6-8-12(9-7-11)23(21,22)15(10-20)13-4-2-3-5-14(13)16(17,18)19/h2-9,15H,10,20H2,1H3/t15-/m0/s1 |
| InChIKey | RFWTYYZNBDMKTA-HNNXBMFYSA-N |
| XLogP | 3.49 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |