C11H13F3N2O4S — CID 68646824
[2-(methanesulfonamido)-1-[2-(trifluoromethyl)phenyl]ethyl]carbamic acid (PubChem CID 68646824) has the molecular formula C11H13F3N2O4S and a molecular weight of 326.30 g/mol. Its IUPAC name is [2-(methanesulfonamido)-1-[2-(trifluoromethyl)phenyl]ethyl]carbamic acid.
| Compound Name | [2-(methanesulfonamido)-1-[2-(trifluoromethyl)phenyl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 68646824 |
| Molecular Formula | C11H13F3N2O4S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | [2-(methanesulfonamido)-1-[2-(trifluoromethyl)phenyl]ethyl]carbamic acid |
| SMILES | CS(=O)(=O)NCC(NC(=O)O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O4S/c1-21(19,20)15-6-9(16-10(17)18)7-4-2-3-5-8(7)11(12,13)14/h2-5,9,15-16H,6H2,1H3,(H,17,18) |
| InChIKey | XZLLYLBLOGJDOW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |