C15H21F3N2O4S — CID 66671984
tert-butyl-[2-(methanesulfonamido)-1-[2-(trifluoromethyl)phenyl]ethyl]carbamic acid (PubChem CID 66671984) has the molecular formula C15H21F3N2O4S and a molecular weight of 382.40 g/mol. Its IUPAC name is tert-butyl-[2-(methanesulfonamido)-1-[2-(trifluoromethyl)phenyl]ethyl]carbamic acid.
| Compound Name | tert-butyl-[2-(methanesulfonamido)-1-[2-(trifluoromethyl)phenyl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 66671984 |
| Molecular Formula | C15H21F3N2O4S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | tert-butyl-[2-(methanesulfonamido)-1-[2-(trifluoromethyl)phenyl]ethyl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C(CNS(C)(=O)=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H21F3N2O4S/c1-14(2,3)20(13(21)22)12(9-19-25(4,23)24)10-7-5-6-8-11(10)15(16,17)18/h5-8,12,19H,9H2,1-4H3,(H,21,22) |
| InChIKey | WSSIODLKMHBLLB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |