C14H15ClFNO3S2 — CID 91631035
N-[2-(5-chlorothiophen-2-yl)-2-methoxyethyl]-4-fluoro-2-methylbenzenesulfonamide (PubChem CID 91631035) has the molecular formula C14H15ClFNO3S2 and a molecular weight of 363.86 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)-2-methoxyethyl]-4-fluoro-2-methylbenzenesulfonamide.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)-2-methoxyethyl]-4-fluoro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 91631035 |
| Molecular Formula | C14H15ClFNO3S2 |
| Molecular Weight | 363.86 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)-2-methoxyethyl]-4-fluoro-2-methylbenzenesulfonamide |
| SMILES | COC(CNS(=O)(=O)c1ccc(F)cc1C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H15ClFNO3S2/c1-9-7-10(16)3-5-13(9)22(18,19)17-8-11(20-2)12-4-6-14(15)21-12/h3-7,11,17H,8H2,1-2H3 |
| InChIKey | ASZOZCAVRCTGQX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.86 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |