C17H17N3O5S — CID 121034447
N-[2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]ethyl]-2-methoxybenzenesulfonamide (PubChem CID 121034447) has the molecular formula C17H17N3O5S and a molecular weight of 375.41 g/mol. Its IUPAC name is N-[2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]ethyl]-2-methoxybenzenesulfonamide.
| Compound Name | N-[2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]ethyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 121034447 |
| Molecular Formula | C17H17N3O5S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-[2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]ethyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccccc1S(=O)(=O)NCCn1nc(-c2ccco2)ccc1=O |
| InChI | InChI=1S/C17H17N3O5S/c1-24-15-5-2-3-7-16(15)26(22,23)18-10-11-20-17(21)9-8-13(19-20)14-6-4-12-25-14/h2-9,12,18H,10-11H2,1H3 |
| InChIKey | CPEMDEGOFAOKCZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |