C16H17N5O4S — CID 90539209
2-methoxy-N-[2-(6-oxo-3-pyrazol-1-ylpyridazin-1-yl)ethyl]benzenesulfonamide (PubChem CID 90539209) has the molecular formula C16H17N5O4S and a molecular weight of 375.41 g/mol. Its IUPAC name is 2-methoxy-N-[2-(6-oxo-3-pyrazol-1-ylpyridazin-1-yl)ethyl]benzenesulfonamide.
| Compound Name | 2-methoxy-N-[2-(6-oxo-3-pyrazol-1-ylpyridazin-1-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90539209 |
| Molecular Formula | C16H17N5O4S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 2-methoxy-N-[2-(6-oxo-3-pyrazol-1-ylpyridazin-1-yl)ethyl]benzenesulfonamide |
| SMILES | COc1ccccc1S(=O)(=O)NCCn1nc(-n2cccn2)ccc1=O |
| InChI | InChI=1S/C16H17N5O4S/c1-25-13-5-2-3-6-14(13)26(23,24)18-10-12-21-16(22)8-7-15(19-21)20-11-4-9-17-20/h2-9,11,18H,10,12H2,1H3 |
| InChIKey | WKFKIWKUUCTSKB-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |