C22H31FN2O3S — CID 30847044
N-(1-adamantylmethyl)-4-[(4-fluorophenyl)sulfonyl-methylamino]butanamide (PubChem CID 30847044) has the molecular formula C22H31FN2O3S and a molecular weight of 422.57 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-4-[(4-fluorophenyl)sulfonyl-methylamino]butanamide.
| Compound Name | N-(1-adamantylmethyl)-4-[(4-fluorophenyl)sulfonyl-methylamino]butanamide |
|---|---|
| PubChem CID | 30847044 |
| Molecular Formula | C22H31FN2O3S |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N-(1-adamantylmethyl)-4-[(4-fluorophenyl)sulfonyl-methylamino]butanamide |
| SMILES | CN(CCCC(=O)NCC12CC3CC(CC(C3)C1)C2)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H31FN2O3S/c1-25(29(27,28)20-6-4-19(23)5-7-20)8-2-3-21(26)24-15-22-12-16-9-17(13-22)11-18(10-16)14-22/h4-7,16-18H,2-3,8-15H2,1H3,(H,24,26) |
| InChIKey | DYYCWEKTAUBSOH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |