C19H29FN2O3S — CID 112816434
N-(4-ethylcyclohexyl)-4-[(4-fluorophenyl)sulfonyl-methylamino]butanamide (PubChem CID 112816434) has the molecular formula C19H29FN2O3S and a molecular weight of 384.52 g/mol. Its IUPAC name is N-(4-ethylcyclohexyl)-4-[(4-fluorophenyl)sulfonyl-methylamino]butanamide.
| Compound Name | N-(4-ethylcyclohexyl)-4-[(4-fluorophenyl)sulfonyl-methylamino]butanamide |
|---|---|
| PubChem CID | 112816434 |
| Molecular Formula | C19H29FN2O3S |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | N-(4-ethylcyclohexyl)-4-[(4-fluorophenyl)sulfonyl-methylamino]butanamide |
| SMILES | CCC1CCC(NC(=O)CCCN(C)S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H29FN2O3S/c1-3-15-6-10-17(11-7-15)21-19(23)5-4-14-22(2)26(24,25)18-12-8-16(20)9-13-18/h8-9,12-13,15,17H,3-7,10-11,14H2,1-2H3,(H,21,23) |
| InChIKey | RJEDVQLMQXHVSM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |