C17H22FN3O — CID 172894946
N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-methylpiperidine-3-carboxamide (PubChem CID 172894946) has the molecular formula C17H22FN3O and a molecular weight of 303.38 g/mol. Its IUPAC name is N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-methylpiperidine-3-carboxamide.
| Compound Name | N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 172894946 |
| Molecular Formula | C17H22FN3O |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-methylpiperidine-3-carboxamide |
| SMILES | CC1(C(=O)NCCc2c[nH]c3cc(F)ccc23)CCCNC1 |
| InChI | InChI=1S/C17H22FN3O/c1-17(6-2-7-19-11-17)16(22)20-8-5-12-10-21-15-9-13(18)3-4-14(12)15/h3-4,9-10,19,21H,2,5-8,11H2,1H3,(H,20,22) |
| InChIKey | SPNNKQBUXVDCGF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |