C23H25FN2O — CID 71885829
1-(4-fluorophenyl)-N-[2-(1H-indol-3-yl)ethyl]cyclohexane-1-carboxamide (PubChem CID 71885829) has the molecular formula C23H25FN2O and a molecular weight of 364.46 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[2-(1H-indol-3-yl)ethyl]cyclohexane-1-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-[2-(1H-indol-3-yl)ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 71885829 |
| Molecular Formula | C23H25FN2O |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[2-(1H-indol-3-yl)ethyl]cyclohexane-1-carboxamide |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)C1(c2ccc(F)cc2)CCCCC1 |
| InChI | InChI=1S/C23H25FN2O/c24-19-10-8-18(9-11-19)23(13-4-1-5-14-23)22(27)25-15-12-17-16-26-21-7-3-2-6-20(17)21/h2-3,6-11,16,26H,1,4-5,12-15H2,(H,25,27) |
| InChIKey | AWXJZVTZKRLUDN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |