C15H18BrFN2O — CID 47223223
1-(2-bromo-4-fluorophenyl)-3-[2-(cyclohexen-1-yl)ethyl]urea (PubChem CID 47223223) has the molecular formula C15H18BrFN2O and a molecular weight of 341.22 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)-3-[2-(cyclohexen-1-yl)ethyl]urea.
| Compound Name | 1-(2-bromo-4-fluorophenyl)-3-[2-(cyclohexen-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 47223223 |
| Molecular Formula | C15H18BrFN2O |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)-3-[2-(cyclohexen-1-yl)ethyl]urea |
| SMILES | O=C(NCCC1=CCCCC1)Nc1ccc(F)cc1Br |
| InChI | InChI=1S/C15H18BrFN2O/c16-13-10-12(17)6-7-14(13)19-15(20)18-9-8-11-4-2-1-3-5-11/h4,6-7,10H,1-3,5,8-9H2,(H2,18,19,20) |
| InChIKey | PIOFZEQKRRARQB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|