C18H24FN3O2 — CID 71973858
3-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-4-fluoro-N,N-dimethylbenzamide (PubChem CID 71973858) has the molecular formula C18H24FN3O2 and a molecular weight of 333.41 g/mol. Its IUPAC name is 3-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-4-fluoro-N,N-dimethylbenzamide.
| Compound Name | 3-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-4-fluoro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 71973858 |
| Molecular Formula | C18H24FN3O2 |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 3-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-4-fluoro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(F)c(NC(=O)NCCC2=CCCCC2)c1 |
| InChI | InChI=1S/C18H24FN3O2/c1-22(2)17(23)14-8-9-15(19)16(12-14)21-18(24)20-11-10-13-6-4-3-5-7-13/h6,8-9,12H,3-5,7,10-11H2,1-2H3,(H2,20,21,24) |
| InChIKey | PYRZJFVJVVGBDI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|