C15H18BrNO2 — CID 114009477
3-bromo-4-[2-(cyclohexen-1-yl)ethylamino]benzoic acid (PubChem CID 114009477) has the molecular formula C15H18BrNO2 and a molecular weight of 324.22 g/mol. Its IUPAC name is 3-bromo-4-[2-(cyclohexen-1-yl)ethylamino]benzoic acid.
| Compound Name | 3-bromo-4-[2-(cyclohexen-1-yl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 114009477 |
| Molecular Formula | C15H18BrNO2 |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 3-bromo-4-[2-(cyclohexen-1-yl)ethylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NCCC2=CCCCC2)c(Br)c1 |
| InChI | InChI=1S/C15H18BrNO2/c16-13-10-12(15(18)19)6-7-14(13)17-9-8-11-4-2-1-3-5-11/h4,6-7,10,17H,1-3,5,8-9H2,(H,18,19) |
| InChIKey | WFKGPBPRJJBRRJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|