C14H18BrN3O — CID 107489144
3-bromo-4-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylamino]benzamide (PubChem CID 107489144) has the molecular formula C14H18BrN3O and a molecular weight of 324.22 g/mol. Its IUPAC name is 3-bromo-4-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylamino]benzamide.
| Compound Name | 3-bromo-4-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylamino]benzamide |
|---|---|
| PubChem CID | 107489144 |
| Molecular Formula | C14H18BrN3O |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 3-bromo-4-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylamino]benzamide |
| SMILES | NC(=O)c1ccc(NCCC2=CCNCC2)c(Br)c1 |
| InChI | InChI=1S/C14H18BrN3O/c15-12-9-11(14(16)19)1-2-13(12)18-8-5-10-3-6-17-7-4-10/h1-3,9,17-18H,4-8H2,(H2,16,19) |
| InChIKey | MLSGLQHRRSXBNO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|